C21H23N3O4S — CID 17205854
4-ethoxy-N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 17205854) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-ethoxy-N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-ethoxy-N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17205854 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-ethoxy-N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-2-28-18-8-6-15(7-9-18)19(25)23-21(29)22-17-5-3-4-16(14-17)20(26)24-10-12-27-13-11-24/h3-9,14H,2,10-13H2,1H3,(H2,22,23,25,29) |
| InChIKey | RYYWTRBCFXQSHZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|