C27H27N3O4S — CID 17205909
N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17205909) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17205909 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[[3-(morpholine-4-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(C(=O)N2CCOCC2)c1)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C27H27N3O4S/c31-25(23-11-4-5-12-24(23)34-16-13-20-7-2-1-3-8-20)29-27(35)28-22-10-6-9-21(19-22)26(32)30-14-17-33-18-15-30/h1-12,19H,13-18H2,(H2,28,29,31,35) |
| InChIKey | VGWKAIFQXDOBPM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|