C24H30N4O3S — CID 26158696
2-butoxy-N-[[3-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 26158696) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-butoxy-N-[[3-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[3-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26158696 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-butoxy-N-[[3-(4-methylpiperazine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)Nc1cccc(C(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H30N4O3S/c1-3-4-16-31-21-11-6-5-10-20(21)22(29)26-24(32)25-19-9-7-8-18(17-19)23(30)28-14-12-27(2)13-15-28/h5-11,17H,3-4,12-16H2,1-2H3,(H2,25,26,29,32) |
| InChIKey | QARUPLWQZZDIQV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|