C19H18Cl2N2O2 — CID 109044703
N-(2,5-dichlorophenyl)-4-(piperidine-1-carbonyl)benzamide (PubChem CID 109044703) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(piperidine-1-carbonyl)benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-(piperidine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109044703 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(piperidine-1-carbonyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c20-15-8-9-16(21)17(12-15)22-18(24)13-4-6-14(7-5-13)19(25)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11H2,(H,22,24) |
| InChIKey | WPZCXMYIIAKWIR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |