C17H14Cl2N2O4 — CID 108956377
methyl 4-[[3-(2,4-dichloroanilino)-3-oxopropanoyl]amino]benzoate (PubChem CID 108956377) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is methyl 4-[[3-(2,4-dichloroanilino)-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 4-[[3-(2,4-dichloroanilino)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108956377 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | methyl 4-[[3-(2,4-dichloroanilino)-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-25-17(24)10-2-5-12(6-3-10)20-15(22)9-16(23)21-14-7-4-11(18)8-13(14)19/h2-8H,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | WREFYPCVOOFCJG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|