C15H11Cl3N2O3 — CID 108992420
methyl 4-chloro-3-[(2,4-dichlorophenyl)carbamoylamino]benzoate (PubChem CID 108992420) has the molecular formula C15H11Cl3N2O3 and a molecular weight of 373.62 g/mol. Its IUPAC name is methyl 4-chloro-3-[(2,4-dichlorophenyl)carbamoylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[(2,4-dichlorophenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108992420 |
| Molecular Formula | C15H11Cl3N2O3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | methyl 4-chloro-3-[(2,4-dichlorophenyl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2O3/c1-23-14(21)8-2-4-10(17)13(6-8)20-15(22)19-12-5-3-9(16)7-11(12)18/h2-7H,1H3,(H2,19,20,22) |
| InChIKey | MNBPDWWVCSLDIP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |