C10H8Cl3NO3 — CID 152656748
methyl 3-chloro-4-[(2,2-dichloroacetyl)amino]benzoate (PubChem CID 152656748) has the molecular formula C10H8Cl3NO3 and a molecular weight of 296.54 g/mol. Its IUPAC name is methyl 3-chloro-4-[(2,2-dichloroacetyl)amino]benzoate.
| Compound Name | methyl 3-chloro-4-[(2,2-dichloroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 152656748 |
| Molecular Formula | C10H8Cl3NO3 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | methyl 3-chloro-4-[(2,2-dichloroacetyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl3NO3/c1-17-10(16)5-2-3-7(6(11)4-5)14-9(15)8(12)13/h2-4,8H,1H3,(H,14,15) |
| InChIKey | ZIRKJQMFUOLTAE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|