C11H12FNO5 — CID 79346581
methyl 4-fluoro-3-(2-hydroxyethoxycarbonylamino)benzoate (PubChem CID 79346581) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is methyl 4-fluoro-3-(2-hydroxyethoxycarbonylamino)benzoate.
| Compound Name | methyl 4-fluoro-3-(2-hydroxyethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 79346581 |
| Molecular Formula | C11H12FNO5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 4-fluoro-3-(2-hydroxyethoxycarbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)OCCO)c1 |
| InChI | InChI=1S/C11H12FNO5/c1-17-10(15)7-2-3-8(12)9(6-7)13-11(16)18-5-4-14/h2-3,6,14H,4-5H2,1H3,(H,13,16) |
| InChIKey | DSCARUCSALDCLA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |