C16H17F3N2O4 — CID 86847008
1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 86847008) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 86847008 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCC(O)c2ccco2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O4/c1-2-24-10-5-6-12(11(8-10)16(17,18)19)21-15(23)20-9-13(22)14-4-3-7-25-14/h3-8,13,22H,2,9H2,1H3,(H2,20,21,23) |
| InChIKey | DMTVNEKHINJQMF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |