C13H15F3N2O2 — CID 47420595
1-cyclopropyl-3-[4-ethoxy-2-(trifluoromethyl)phenyl]urea (PubChem CID 47420595) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-ethoxy-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-cyclopropyl-3-[4-ethoxy-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 47420595 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-cyclopropyl-3-[4-ethoxy-2-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1ccc(NC(=O)NC2CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O2/c1-2-20-9-5-6-11(10(7-9)13(14,15)16)18-12(19)17-8-3-4-8/h5-8H,2-4H2,1H3,(H2,17,18,19) |
| InChIKey | OVWHRUMQVKNLDH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |