C21H24F3N3O3 — CID 60589161
2-[[4-ethoxy-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]-N-(2-ethylphenyl)acetamide (PubChem CID 60589161) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is 2-[[4-ethoxy-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[[4-ethoxy-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 60589161 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[[4-ethoxy-2-(trifluoromethyl)phenyl]carbamoyl-methylamino]-N-(2-ethylphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)N(C)CC(=O)Nc2ccccc2CC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F3N3O3/c1-4-14-8-6-7-9-17(14)25-19(28)13-27(3)20(29)26-18-11-10-15(30-5-2)12-16(18)21(22,23)24/h6-12H,4-5,13H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | NYQRCXLIWHBTHA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |