C22H25F3N2O4 — CID 24983106
3-(4-ethoxyphenoxy)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide (PubChem CID 24983106) has the molecular formula C22H25F3N2O4 and a molecular weight of 438.45 g/mol. Its IUPAC name is 3-(4-ethoxyphenoxy)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide.
| Compound Name | 3-(4-ethoxyphenoxy)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide |
|---|---|
| PubChem CID | 24983106 |
| Molecular Formula | C22H25F3N2O4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 3-(4-ethoxyphenoxy)-N-ethyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]propanamide |
| SMILES | CCOc1ccc(OCCC(=O)N(CC)CC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N2O4/c1-3-27(15-20(28)26-19-8-6-5-7-18(19)22(23,24)25)21(29)13-14-31-17-11-9-16(10-12-17)30-4-2/h5-12H,3-4,13-15H2,1-2H3,(H,26,28) |
| InChIKey | BGQVBVLJKQIJSX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |