C17H23F3N2O2 — CID 134059299
N-ethyl-4-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pentanamide (PubChem CID 134059299) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pentanamide.
| Compound Name | N-ethyl-4-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pentanamide |
|---|---|
| PubChem CID | 134059299 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-ethyl-4-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pentanamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)CCC(C)C |
| InChI | InChI=1S/C17H23F3N2O2/c1-4-22(16(24)10-9-12(2)3)11-15(23)21-14-8-6-5-7-13(14)17(18,19)20/h5-8,12H,4,9-11H2,1-3H3,(H,21,23) |
| InChIKey | XUOLCNAUWWXSDV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |