C19H28F3N3O2 — CID 60589064
1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea (PubChem CID 60589064) has the molecular formula C19H28F3N3O2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 60589064 |
| Molecular Formula | C19H28F3N3O2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[4-ethoxy-2-(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidin-1-yl)propyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCCN2CCC(C)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H28F3N3O2/c1-3-27-15-5-6-17(16(13-15)19(20,21)22)24-18(26)23-9-4-10-25-11-7-14(2)8-12-25/h5-6,13-14H,3-4,7-12H2,1-2H3,(H2,23,24,26) |
| InChIKey | TUTXNGKXSUAUJG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|