C15H24N2O3 — CID 115569945
1-butyl-3-(2,5-diethoxyphenyl)urea (PubChem CID 115569945) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-butyl-3-(2,5-diethoxyphenyl)urea.
| Compound Name | 1-butyl-3-(2,5-diethoxyphenyl)urea |
|---|---|
| PubChem CID | 115569945 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-butyl-3-(2,5-diethoxyphenyl)urea |
| SMILES | CCCCNC(=O)Nc1cc(OCC)ccc1OCC |
| InChI | InChI=1S/C15H24N2O3/c1-4-7-10-16-15(18)17-13-11-12(19-5-2)8-9-14(13)20-6-3/h8-9,11H,4-7,10H2,1-3H3,(H2,16,17,18) |
| InChIKey | RHTGVXPOCLZXNM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|