C20H27N3O5S — CID 4799139
1-butyl-3-[5-[(4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]urea (PubChem CID 4799139) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-butyl-3-[5-[(4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]urea.
| Compound Name | 1-butyl-3-[5-[(4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]urea |
|---|---|
| PubChem CID | 4799139 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-butyl-3-[5-[(4-ethoxyphenyl)sulfamoyl]-2-methoxyphenyl]urea |
| SMILES | CCCCNC(=O)Nc1cc(S(=O)(=O)Nc2ccc(OCC)cc2)ccc1OC |
| InChI | InChI=1S/C20H27N3O5S/c1-4-6-13-21-20(24)22-18-14-17(11-12-19(18)27-3)29(25,26)23-15-7-9-16(10-8-15)28-5-2/h7-12,14,23H,4-6,13H2,1-3H3,(H2,21,22,24) |
| InChIKey | NOYOQZDFQCRFLA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|