C17H21N3O4S — CID 4803273
1-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea (PubChem CID 4803273) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea.
| Compound Name | 1-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea |
|---|---|
| PubChem CID | 4803273 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1cccc(S(=O)(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C17H21N3O4S/c1-3-11-18-17(21)19-14-5-4-6-16(12-14)25(22,23)20-13-7-9-15(24-2)10-8-13/h4-10,12,20H,3,11H2,1-2H3,(H2,18,19,21) |
| InChIKey | RHQOQWDIIYPRGU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |