C19H24N2O4S — CID 38765461
N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3,3-dimethylbutanamide (PubChem CID 38765461) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 38765461 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(NC(=O)CC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-19(2,3)13-18(22)20-15-6-5-7-17(12-15)26(23,24)21-14-8-10-16(25-4)11-9-14/h5-12,21H,13H2,1-4H3,(H,20,22) |
| InChIKey | GHHIUGKXGQKKEY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |