C16H18N4O5S — CID 18168699
2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 18168699) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 18168699 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(NC(=O)CNC(N)=O)c2)cc1 |
| InChI | InChI=1S/C16H18N4O5S/c1-25-13-7-5-11(6-8-13)20-26(23,24)14-4-2-3-12(9-14)19-15(21)10-18-16(17)22/h2-9,20H,10H2,1H3,(H,19,21)(H3,17,18,22) |
| InChIKey | AEOVWRBLXCXYFZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |