C17H20ClN3O4S — CID 4803245
1-[2-chloro-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea (PubChem CID 4803245) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is 1-[2-chloro-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea.
| Compound Name | 1-[2-chloro-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea |
|---|---|
| PubChem CID | 4803245 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-[2-chloro-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1cc(S(=O)(=O)Nc2ccc(OC)cc2)ccc1Cl |
| InChI | InChI=1S/C17H20ClN3O4S/c1-3-10-19-17(22)20-16-11-14(8-9-15(16)18)26(23,24)21-12-4-6-13(25-2)7-5-12/h4-9,11,21H,3,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | PTQJSCDNWVGWKF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |