C18H22N2O5S — CID 25335054
(2S)-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide (PubChem CID 25335054) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is (2S)-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide.
| Compound Name | (2S)-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 25335054 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2S)-N-[2-hydroxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylbutanamide |
| SMILES | CC[C@H](C)C(=O)Nc1cc(S(=O)(=O)Nc2ccc(OC)cc2)ccc1O |
| InChI | InChI=1S/C18H22N2O5S/c1-4-12(2)18(22)19-16-11-15(9-10-17(16)21)26(23,24)20-13-5-7-14(25-3)8-6-13/h5-12,20-21H,4H2,1-3H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | MQLHSBVYOWDZGP-LBPRGKRZSA-N |
| XLogP | 3.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|