C22H21N3O7S — CID 20969932
N'-[2-hydroxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]-N-(4-methoxyphenyl)oxamide (PubChem CID 20969932) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is N'-[2-hydroxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]-N-(4-methoxyphenyl)oxamide.
| Compound Name | N'-[2-hydroxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]-N-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 20969932 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N'-[2-hydroxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]-N-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(OC)cc3)cc2O)cc1 |
| InChI | InChI=1S/C22H21N3O7S/c1-31-16-7-3-14(4-8-16)23-21(27)22(28)24-19-12-11-18(13-20(19)26)33(29,30)25-15-5-9-17(32-2)10-6-15/h3-13,25-26H,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | FFKSSNASMANPSY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|