C20H20N4O4S — CID 166423475
1-(4-aminophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea (PubChem CID 166423475) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 166423475 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-(4-aminophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-28-18-10-6-17(7-11-18)24-29(26,27)19-12-8-16(9-13-19)23-20(25)22-15-4-2-14(21)3-5-15/h2-13,24H,21H2,1H3,(H2,22,23,25) |
| InChIKey | LEZXEUVQTAIKRD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|