C14H16N4O3S — CID 108875138
1-(4-aminophenyl)-3-[4-(methanesulfonamido)phenyl]urea (PubChem CID 108875138) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[4-(methanesulfonamido)phenyl]urea.
| Compound Name | 1-(4-aminophenyl)-3-[4-(methanesulfonamido)phenyl]urea |
|---|---|
| PubChem CID | 108875138 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(4-aminophenyl)-3-[4-(methanesulfonamido)phenyl]urea |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C14H16N4O3S/c1-22(20,21)18-13-8-6-12(7-9-13)17-14(19)16-11-4-2-10(15)3-5-11/h2-9,18H,15H2,1H3,(H2,16,17,19) |
| InChIKey | HPBJMEYXHNHFSV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|