C11H15N3O5S — CID 108875415
methyl 2-[[4-(methanesulfonamido)phenyl]carbamoylamino]acetate (PubChem CID 108875415) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is methyl 2-[[4-(methanesulfonamido)phenyl]carbamoylamino]acetate.
| Compound Name | methyl 2-[[4-(methanesulfonamido)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 108875415 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | methyl 2-[[4-(methanesulfonamido)phenyl]carbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)Nc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15N3O5S/c1-19-10(15)7-12-11(16)13-8-3-5-9(6-4-8)14-20(2,17)18/h3-6,14H,7H2,1-2H3,(H2,12,13,16) |
| InChIKey | QLBZPTWBORTGRR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |