C11H11F3N2O4 — CID 115565125
methyl 2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]acetate (PubChem CID 115565125) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is methyl 2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]acetate.
| Compound Name | methyl 2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 115565125 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | methyl 2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3N2O4/c1-19-9(17)6-15-10(18)16-7-2-4-8(5-3-7)20-11(12,13)14/h2-5H,6H2,1H3,(H2,15,16,18) |
| InChIKey | QELIGNBEDXAJII-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |