C13H13F3N2O2 — CID 115976976
1-pent-3-ynyl-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 115976976) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 1-pent-3-ynyl-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-pent-3-ynyl-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 115976976 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-pent-3-ynyl-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CC#CCCNC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N2O2/c1-2-3-4-9-17-12(19)18-10-5-7-11(8-6-10)20-13(14,15)16/h5-8H,4,9H2,1H3,(H2,17,18,19) |
| InChIKey | AFPUZUSZOQXZNN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|