C13H15F3N2O2 — CID 115629281
1-[(E)-pent-3-enyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 115629281) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-[(E)-pent-3-enyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(E)-pent-3-enyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 115629281 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[(E)-pent-3-enyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | C/C=C/CCNC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O2/c1-2-3-4-9-17-12(19)18-10-5-7-11(8-6-10)20-13(14,15)16/h2-3,5-8H,4,9H2,1H3,(H2,17,18,19)/b3-2+ |
| InChIKey | OBCMPYHECLQJFQ-NSCUHMNNSA-N |
| XLogP | 3.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|