C18H26F4N2O4 — CID 143831258
ethyl (Z)-2-fluoro-8-[[4-(trifluoromethoxy)phenyl]carbamoylamino]oct-2-enoate;molecular hydrogen (PubChem CID 143831258) has the molecular formula C18H26F4N2O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-8-[[4-(trifluoromethoxy)phenyl]carbamoylamino]oct-2-enoate;molecular hydrogen.
| Compound Name | ethyl (Z)-2-fluoro-8-[[4-(trifluoromethoxy)phenyl]carbamoylamino]oct-2-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 143831258 |
| Molecular Formula | C18H26F4N2O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | ethyl (Z)-2-fluoro-8-[[4-(trifluoromethoxy)phenyl]carbamoylamino]oct-2-enoate;molecular hydrogen |
| SMILES | CCOC(=O)/C(F)=C/CCCCCNC(=O)Nc1ccc(OC(F)(F)F)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C18H22F4N2O4.2H2/c1-2-27-16(25)15(19)7-5-3-4-6-12-23-17(26)24-13-8-10-14(11-9-13)28-18(20,21)22;;/h7-11H,2-6,12H2,1H3,(H2,23,24,26);2*1H/b15-7-;; |
| InChIKey | HRXIROZRIVLEJG-XRXZUQKVSA-N |
| XLogP | 5.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|