C16H18F4N2O3 — CID 68878653
2-fluoro-8-[[4-(trifluoromethyl)phenyl]carbamoylamino]oct-2-enoic acid (PubChem CID 68878653) has the molecular formula C16H18F4N2O3 and a molecular weight of 362.32 g/mol. Its IUPAC name is 2-fluoro-8-[[4-(trifluoromethyl)phenyl]carbamoylamino]oct-2-enoic acid.
| Compound Name | 2-fluoro-8-[[4-(trifluoromethyl)phenyl]carbamoylamino]oct-2-enoic acid |
|---|---|
| PubChem CID | 68878653 |
| Molecular Formula | C16H18F4N2O3 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-fluoro-8-[[4-(trifluoromethyl)phenyl]carbamoylamino]oct-2-enoic acid |
| SMILES | O=C(NCCCCCC=C(F)C(=O)O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F4N2O3/c17-13(14(23)24)5-3-1-2-4-10-21-15(25)22-12-8-6-11(7-9-12)16(18,19)20/h5-9H,1-4,10H2,(H,23,24)(H2,21,22,25) |
| InChIKey | QUKOQWBQAYVVQF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|