C13H14F3N3O — CID 63297615
1-(4-cyanobutyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 63297615) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 1-(4-cyanobutyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-cyanobutyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 63297615 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-(4-cyanobutyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | N#CCCCCNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O/c14-13(15,16)10-4-6-11(7-5-10)19-12(20)18-9-3-1-2-8-17/h4-7H,1-3,9H2,(H2,18,19,20) |
| InChIKey | NFZNZIDZUOGYML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|