C16H22N2O6 — CID 108865498
6-[(4-ethoxycarbonyloxyphenyl)carbamoylamino]hexanoic acid (PubChem CID 108865498) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 6-[(4-ethoxycarbonyloxyphenyl)carbamoylamino]hexanoic acid.
| Compound Name | 6-[(4-ethoxycarbonyloxyphenyl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 108865498 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-[(4-ethoxycarbonyloxyphenyl)carbamoylamino]hexanoic acid |
| SMILES | CCOC(=O)Oc1ccc(NC(=O)NCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O6/c1-2-23-16(22)24-13-9-7-12(8-10-13)18-15(21)17-11-5-3-4-6-14(19)20/h7-10H,2-6,11H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | BGBURQKSPOYMBE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|