C22H20N2O5 — CID 108865510
ethyl [4-[(4-phenoxyphenyl)carbamoylamino]phenyl] carbonate (PubChem CID 108865510) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is ethyl [4-[(4-phenoxyphenyl)carbamoylamino]phenyl] carbonate.
| Compound Name | ethyl [4-[(4-phenoxyphenyl)carbamoylamino]phenyl] carbonate |
|---|---|
| PubChem CID | 108865510 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | ethyl [4-[(4-phenoxyphenyl)carbamoylamino]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(NC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O5/c1-2-27-22(26)29-20-14-10-17(11-15-20)24-21(25)23-16-8-12-19(13-9-16)28-18-6-4-3-5-7-18/h3-15H,2H2,1H3,(H2,23,24,25) |
| InChIKey | BDRBBVGTJQLTTM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|