C21H25N3O4 — CID 108865631
ethyl [4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl] carbonate (PubChem CID 108865631) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl [4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl] carbonate.
| Compound Name | ethyl [4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl] carbonate |
|---|---|
| PubChem CID | 108865631 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | ethyl [4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(NC(=O)Nc2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-2-27-21(26)28-19-12-8-17(9-13-19)23-20(25)22-16-6-10-18(11-7-16)24-14-4-3-5-15-24/h6-13H,2-5,14-15H2,1H3,(H2,22,23,25) |
| InChIKey | MTEDXTQQLHYBLD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|