C18H17F4N3O3 — CID 47987463
2-fluoro-N-[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propyl]benzamide (PubChem CID 47987463) has the molecular formula C18H17F4N3O3 and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-fluoro-N-[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 47987463 |
| Molecular Formula | C18H17F4N3O3 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-fluoro-N-[3-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propyl]benzamide |
| SMILES | O=C(NCCCNC(=O)c1ccccc1F)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F4N3O3/c19-15-5-2-1-4-14(15)16(26)23-10-3-11-24-17(27)25-12-6-8-13(9-7-12)28-18(20,21)22/h1-2,4-9H,3,10-11H2,(H,23,26)(H2,24,25,27) |
| InChIKey | ALCRQNOEFDEZBJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|