C19H22FN3O4 — CID 47987974
N-[3-[(2,4-dimethoxyphenyl)carbamoylamino]propyl]-2-fluorobenzamide (PubChem CID 47987974) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[3-[(2,4-dimethoxyphenyl)carbamoylamino]propyl]-2-fluorobenzamide.
| Compound Name | N-[3-[(2,4-dimethoxyphenyl)carbamoylamino]propyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 47987974 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[3-[(2,4-dimethoxyphenyl)carbamoylamino]propyl]-2-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)NCCCNC(=O)c2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C19H22FN3O4/c1-26-13-8-9-16(17(12-13)27-2)23-19(25)22-11-5-10-21-18(24)14-6-3-4-7-15(14)20/h3-4,6-9,12H,5,10-11H2,1-2H3,(H,21,24)(H2,22,23,25) |
| InChIKey | QNNPFBDATDPXTN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|