C18H22N2O4 — CID 90499727
1-(2,4-dimethoxyphenyl)-3-(3-hydroxy-3-phenylpropyl)urea (PubChem CID 90499727) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(3-hydroxy-3-phenylpropyl)urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(3-hydroxy-3-phenylpropyl)urea |
|---|---|
| PubChem CID | 90499727 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(3-hydroxy-3-phenylpropyl)urea |
| SMILES | COc1ccc(NC(=O)NCCC(O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O4/c1-23-14-8-9-15(17(12-14)24-2)20-18(22)19-11-10-16(21)13-6-4-3-5-7-13/h3-9,12,16,21H,10-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | OCINFTYBTMUUJX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |