C19H33N3O3 — CID 74226685
1-[2-(dibutylamino)ethyl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 74226685) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-[2-(dibutylamino)ethyl]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[2-(dibutylamino)ethyl]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 74226685 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 1-[2-(dibutylamino)ethyl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | CCCCN(CCCC)CCNC(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H33N3O3/c1-5-7-12-22(13-8-6-2)14-11-20-19(23)21-17-10-9-16(24-3)15-18(17)25-4/h9-10,15H,5-8,11-14H2,1-4H3,(H2,20,21,23) |
| InChIKey | WOTWPXCZVYANRI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |