C14H13ClFN3O3S — CID 108875348
1-(3-chloro-4-fluorophenyl)-3-[4-(methanesulfonamido)phenyl]urea (PubChem CID 108875348) has the molecular formula C14H13ClFN3O3S and a molecular weight of 357.79 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[4-(methanesulfonamido)phenyl]urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(methanesulfonamido)phenyl]urea |
|---|---|
| PubChem CID | 108875348 |
| Molecular Formula | C14H13ClFN3O3S |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[4-(methanesulfonamido)phenyl]urea |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H13ClFN3O3S/c1-23(21,22)19-10-4-2-9(3-5-10)17-14(20)18-11-6-7-13(16)12(15)8-11/h2-8,19H,1H3,(H2,17,18,20) |
| InChIKey | OHJMEYBQSQDPSC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |