C15H16N4O4S — CID 108875346
4-amino-N-[[4-(methanesulfonamido)phenyl]carbamoyl]benzamide (PubChem CID 108875346) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-amino-N-[[4-(methanesulfonamido)phenyl]carbamoyl]benzamide.
| Compound Name | 4-amino-N-[[4-(methanesulfonamido)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 108875346 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-amino-N-[[4-(methanesulfonamido)phenyl]carbamoyl]benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)NC(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C15H16N4O4S/c1-24(22,23)19-13-8-6-12(7-9-13)17-15(21)18-14(20)10-2-4-11(16)5-3-10/h2-9,19H,16H2,1H3,(H2,17,18,20,21) |
| InChIKey | TUQMFWKHBCTWMH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|