C16H16N2O5S — CID 967516
methyl 4-[[4-(methanesulfonamido)benzoyl]amino]benzoate (PubChem CID 967516) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is methyl 4-[[4-(methanesulfonamido)benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[4-(methanesulfonamido)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 967516 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | methyl 4-[[4-(methanesulfonamido)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c1-23-16(20)12-5-7-13(8-6-12)17-15(19)11-3-9-14(10-4-11)18-24(2,21)22/h3-10,18H,1-2H3,(H,17,19) |
| InChIKey | ZSLYZAWRFJAPNG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |