C16H16N2O6S — CID 108767152
methyl 3-hydroxy-4-[[4-(methanesulfonamido)benzoyl]amino]benzoate (PubChem CID 108767152) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[[4-(methanesulfonamido)benzoyl]amino]benzoate.
| Compound Name | methyl 3-hydroxy-4-[[4-(methanesulfonamido)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 108767152 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | methyl 3-hydroxy-4-[[4-(methanesulfonamido)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(NS(C)(=O)=O)cc2)c(O)c1 |
| InChI | InChI=1S/C16H16N2O6S/c1-24-16(21)11-5-8-13(14(19)9-11)17-15(20)10-3-6-12(7-4-10)18-25(2,22)23/h3-9,18-19H,1-2H3,(H,17,20) |
| InChIKey | OOFBTHVIPOMAKP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|