C15H15IN2O3S — CID 1249872
N-(4-iodo-2-methylphenyl)-4-(methanesulfonamido)benzamide (PubChem CID 1249872) has the molecular formula C15H15IN2O3S and a molecular weight of 430.27 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-4-(methanesulfonamido)benzamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 1249872 |
| Molecular Formula | C15H15IN2O3S |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-4-(methanesulfonamido)benzamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H15IN2O3S/c1-10-9-12(16)5-8-14(10)17-15(19)11-3-6-13(7-4-11)18-22(2,20)21/h3-9,18H,1-2H3,(H,17,19) |
| InChIKey | IKRFCYLAYJCYIU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|