C17H16INO — CID 46803663
N-(4-iodo-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 46803663) has the molecular formula C17H16INO and a molecular weight of 377.23 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 46803663 |
| Molecular Formula | C17H16INO |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H16INO/c1-11-9-15(18)7-8-16(11)19-17(20)14-6-5-12-3-2-4-13(12)10-14/h5-10H,2-4H2,1H3,(H,19,20) |
| InChIKey | VQYIOWBMTVKEHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|