C17H16ClNO — CID 9011354
N-(3-chloro-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 9011354) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 9011354 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H16ClNO/c1-11-15(18)6-3-7-16(11)19-17(20)14-9-8-12-4-2-5-13(12)10-14/h3,6-10H,2,4-5H2,1H3,(H,19,20) |
| InChIKey | LGESIYIEKFMZGN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |