C17H16N2O3 — CID 9011538
N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 9011538) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 9011538 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc3c(c2)CCC3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N2O3/c1-11-15(6-3-7-16(11)19(21)22)18-17(20)14-9-8-12-4-2-5-13(12)10-14/h3,6-10H,2,4-5H2,1H3,(H,18,20) |
| InChIKey | HOTYRQCJNCJNIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|