C20H16ClN3O3 — CID 46257991
9-chloro-N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-6-carboxamide (PubChem CID 46257991) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is 9-chloro-N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-6-carboxamide.
| Compound Name | 9-chloro-N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 46257991 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 9-chloro-N-(2-methyl-3-nitrophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-6-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc3c(Cl)c4c(nc3c2)CCC4)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN3O3/c1-11-15(5-3-7-18(11)24(26)27)23-20(25)12-8-9-14-17(10-12)22-16-6-2-4-13(16)19(14)21/h3,5,7-10H,2,4,6H2,1H3,(H,23,25) |
| InChIKey | AVYDUTFTIGDRKG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|