C17H16BrNO — CID 82707017
N-(2-bromo-5-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 82707017) has the molecular formula C17H16BrNO and a molecular weight of 330.23 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-(2-bromo-5-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 82707017 |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | Cc1ccc(Br)c(NC(=O)c2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C17H16BrNO/c1-11-5-8-15(18)16(9-11)19-17(20)14-7-6-12-3-2-4-13(12)10-14/h5-10H,2-4H2,1H3,(H,19,20) |
| InChIKey | ACCLXQAAQBKAEH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |