C15H18N4O3S — CID 108875405
1-(2-amino-5-methylphenyl)-3-[4-(methanesulfonamido)phenyl]urea (PubChem CID 108875405) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(2-amino-5-methylphenyl)-3-[4-(methanesulfonamido)phenyl]urea.
| Compound Name | 1-(2-amino-5-methylphenyl)-3-[4-(methanesulfonamido)phenyl]urea |
|---|---|
| PubChem CID | 108875405 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(2-amino-5-methylphenyl)-3-[4-(methanesulfonamido)phenyl]urea |
| SMILES | Cc1ccc(N)c(NC(=O)Nc2ccc(NS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C15H18N4O3S/c1-10-3-8-13(16)14(9-10)18-15(20)17-11-4-6-12(7-5-11)19-23(2,21)22/h3-9,19H,16H2,1-2H3,(H2,17,18,20) |
| InChIKey | XYBWQADVFRGWDS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|