C19H23N3O2 — CID 108529851
N'-(2-amino-5-methylphenyl)-N-(4-tert-butylphenyl)oxamide (PubChem CID 108529851) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N'-(2-amino-5-methylphenyl)-N-(4-tert-butylphenyl)oxamide.
| Compound Name | N'-(2-amino-5-methylphenyl)-N-(4-tert-butylphenyl)oxamide |
|---|---|
| PubChem CID | 108529851 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N'-(2-amino-5-methylphenyl)-N-(4-tert-butylphenyl)oxamide |
| SMILES | Cc1ccc(N)c(NC(=O)C(=O)Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-12-5-10-15(20)16(11-12)22-18(24)17(23)21-14-8-6-13(7-9-14)19(2,3)4/h5-11H,20H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | FVRWUYOCRGAVQF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|